cas: 918132-14-6 — see every product listed under this CAS number, including other names
Boc-Aminoxy-PEG4-OH, 97% (CAS 918132-14-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F554719-250MG |
| cas | 918132-14-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 435.28 Pln | |
| Fluorochem | 500mg | 810.15 Pln | |
| Fluorochem | 1g | 1559.89 Pln | |
| Fluorochem | 5g | 4871.22 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]carbamate (CAS 918132-14-6) is a chemical compound with the molecular formula C13H27NO7 and a molecular weight of 309.36 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]carbamate. InChIKey: CHEZAYNNNOMTTB-UHFFFAOYSA-N.
| Molecular formula | C13H27NO7 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]carbamate |
| InChIKey | CHEZAYNNNOMTTB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NOCCOCCOCCOCCO |
Computed by PubChem (NCBI)