cas: 132388-68-2 — see every product listed under this CAS number, including other names
Boc-Asn(Trt)-OH 98% (CAS 132388-68-2) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A164982-1000g |
| cas | 132388-68-2 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 4425.44 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 275.81 Pln | |
| Ambeed | 100g | 748.62 Pln | |
| Ambeed | 500g | 2795.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A164982 |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(tritylamino)butanoic acid (CAS 132388-68-2) is a chemical compound with the molecular formula C28H30N2O5 and a molecular weight of 474.5 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(tritylamino)butanoic acid. InChIKey: PYGOCFDOBSXROC-QHCPKHFHSA-N.
| Molecular formula | C28H30N2O5 |
|---|---|
| Molecular weight | 474.5 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(tritylamino)butanoic acid |
| InChIKey | PYGOCFDOBSXROC-QHCPKHFHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)