cas: 132388-68-2 — see every product listed under this CAS number, including other names
Boc-Asn(Trt)-OH, 98%, 98% (CAS 132388-68-2) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1kg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1121ML-500g |
| cas | 132388-68-2 |
| size | 500g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 500g | 1492.80 Pln | |
| Chemat | 1kg | 2358.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 100g | 333.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(tritylamino)butanoic acid (CAS 132388-68-2) is a chemical compound with the molecular formula C28H30N2O5 and a molecular weight of 474.5 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(tritylamino)butanoic acid. InChIKey: PYGOCFDOBSXROC-QHCPKHFHSA-N.
| Molecular formula | C28H30N2O5 |
|---|---|
| Molecular weight | 474.5 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(tritylamino)butanoic acid |
| InChIKey | PYGOCFDOBSXROC-QHCPKHFHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)