cas: 501015-18-5 — see every product listed under this CAS number, including other names
Boc-D-β-Phe(3-CF3)-OH 91% (CAS 501015-18-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A737838-100mg |
| cas | 501015-18-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1071.25 Pln | |
| Ambeed | 5g | 3613.31 Pln |
| purity | 91% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A737838 |
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(trifluoromethyl)phenyl]propanoic acid (CAS 501015-18-5) is a chemical compound with the molecular formula C15H18F3NO4 and a molecular weight of 333.30 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(trifluoromethyl)phenyl]propanoic acid. InChIKey: UPKLBXIBSSZUID-LLVKDONJSA-N.
| Molecular formula | C15H18F3NO4 |
|---|---|
| Molecular weight | 333.30 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | UPKLBXIBSSZUID-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C1=CC(=CC=C1)C(F)(F)F |
Computed by PubChem (NCBI)