CAS 113712-06-4 appears in our catalog under these names: Boc-D-Arg-OH·HCl, 97%, BOC–D–ARG–OH·HCL·H2O, Boc-D-Arg-OH*H2O*HCl, Boc-D-Arg-OH.HCl, 97%, 97%, N-Boc-D-Arg (hydrochloride), 98.0%. Offered by: AmBeed, GLPBio, Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 500g, 5g, 25g, 1g, 10g, 100g, 100 g, 10 g.
(2R)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrochloride (CAS 113712-06-4) is a chemical compound with the molecular formula C11H23ClN4O4 and a molecular weight of 310.78 g/mol. IUPAC name: (2R)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrochloride. InChIKey: HDELGKMVZYHPPB-OGFXRTJISA-N.
| Molecular formula | C11H23ClN4O4 |
|---|---|
| Molecular weight | 310.78 g/mol |
| IUPAC name | (2R)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrochloride |
| InChIKey | HDELGKMVZYHPPB-OGFXRTJISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCN=C(N)N)C(=O)O.Cl |
Computed by PubChem (NCBI)