CAS 35897-34-8 appears in our catalog under these names: NAlpha-Boc-L-arginine Hydrochloride, Boc–Arg–OH·HCl·H2O, Nalpha-Boc-L-arginine hydrochloride hydrate, 98% , Boc-Arg-OH·HCl 97%, Boc-Arg-OH.HCl, 97%, 97%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 50g, 5g, 25g, 10g, 100g, 500g, 1000g, 100 g.
(2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrochloride (CAS 35897-34-8) is a chemical compound with the molecular formula C11H23ClN4O4 and a molecular weight of 310.78 g/mol. IUPAC name: (2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrochloride. InChIKey: HDELGKMVZYHPPB-FJXQXJEOSA-N.
| Molecular formula | C11H23ClN4O4 |
|---|---|
| Molecular weight | 310.78 g/mol |
| IUPAC name | (2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrochloride |
| InChIKey | HDELGKMVZYHPPB-FJXQXJEOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCN=C(N)N)C(=O)O.Cl |
Computed by PubChem (NCBI)