cas: 393568-74-6 — see every product listed under this CAS number, including other names
Boc-D-His(Trt)-OH, 99.34% (CAS 393568-74-6) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 50 g, 10 g, 25 g, 1 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W051937-100 g |
| cas | 393568-74-6 |
| size | 100 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 2650.98 Pln | |
| MedChemExpress | 50 g | 1703.60 Pln | |
| MedChemExpress | 10 g | 616.91 Pln | |
| MedChemExpress | 25 g | 1113.82 Pln | |
| MedChemExpress | 1 g | 245.39 Pln | |
| MedChemExpress | 5 g | 431.15 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.34% |
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-tritylimidazol-4-yl)propanoic acid (CAS 393568-74-6) is a chemical compound with the molecular formula C30H31N3O4 and a molecular weight of 497.6 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-tritylimidazol-4-yl)propanoic acid. InChIKey: OYXZPXVCRAAKCM-AREMUKBSSA-N.
| Molecular formula | C30H31N3O4 |
|---|---|
| Molecular weight | 497.6 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-tritylimidazol-4-yl)propanoic acid |
| InChIKey | OYXZPXVCRAAKCM-AREMUKBSSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CN(C=N1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)O |
Computed by PubChem (NCBI)