CAS 32926-43-5 appears in our catalog under these names: Boc-His(Trt)-OH, >95% (HPLC), Boc–His(Trt)–OH, Boc-L-His(Trt)-OH, Boc-His(Trt)-OH, Boc-His(Trt)-OH 98%. Offered by: TRC, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 10g, 1g, 100g, 25g, 500g, 0,01kg, 0,025kg, 0,05kg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-tritylimidazol-4-yl)propanoic acid (CAS 32926-43-5) is a chemical compound with the molecular formula C30H31N3O4 and a molecular weight of 497.6 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-tritylimidazol-4-yl)propanoic acid. InChIKey: OYXZPXVCRAAKCM-SANMLTNESA-N.
| Molecular formula | C30H31N3O4 |
|---|---|
| Molecular weight | 497.6 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-tritylimidazol-4-yl)propanoic acid |
| InChIKey | OYXZPXVCRAAKCM-SANMLTNESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CN(C=N1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)O |
Computed by PubChem (NCBI)