CAS 1301706-43-3 appears in our catalog under these names: Boc–D–Homocys(Trt)–OH, Boc-D-HCys(Trt)-OH, (R)-2-((tert-Butoxycarbonyl)amino)-4-(tritylthio)butanoic acid, 98%, 98%. Offered by: GLPBio, Iris Biotech, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-tritylsulfanylbutanoic acid (CAS 1301706-43-3) is a chemical compound with the molecular formula C28H31NO4S and a molecular weight of 477.6 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-tritylsulfanylbutanoic acid. InChIKey: YBAYCOKLWMVUSV-XMMPIXPASA-N.
| Molecular formula | C28H31NO4S |
|---|---|
| Molecular weight | 477.6 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-tritylsulfanylbutanoic acid |
| InChIKey | YBAYCOKLWMVUSV-XMMPIXPASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)