CAS 201419-16-1 appears in our catalog under these names: Boc–Homocys(Trt)–OH, Boc-L-HCys(Trt)-OH, Boc-S-trityl-L-homocysteine, L-Homocysteine,N-[(1,1-dimethylethoxy)carbonyl]-S-(triphenylmethyl)-, 98%, 98%, Boc-L-HomoCys(Trt)-OH, 95%. Offered by: GLPBio, Iris Biotech, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg, 500mg, 1000mg, 50g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-tritylsulfanylbutanoic acid (CAS 201419-16-1) is a chemical compound with the molecular formula C28H31NO4S and a molecular weight of 477.6 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-tritylsulfanylbutanoic acid. InChIKey: YBAYCOKLWMVUSV-DEOSSOPVSA-N.
| Molecular formula | C28H31NO4S |
|---|---|
| Molecular weight | 477.6 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-tritylsulfanylbutanoic acid |
| InChIKey | YBAYCOKLWMVUSV-DEOSSOPVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)