cas: 65360-27-2 — see every product listed under this CAS number, including other names
Boc-D-Lys(Boc)-OH 95% (CAS 65360-27-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A163520-250mg |
| cas | 65360-27-2 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 159.00 Pln | |
| Ambeed | 5g | 320.31 Pln | |
| Ambeed | 10g | 476.06 Pln | |
| Ambeed | 25g | 848.75 Pln | |
| Ambeed | 100g | 2951.38 Pln | |
| Ambeed | 500g | 11595.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A163520 |
(2R)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 65360-27-2) is a chemical compound with the molecular formula C16H30N2O6 and a molecular weight of 346.42 g/mol. IUPAC name: (2R)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: FBVSXKMMQOZUNU-LLVKDONJSA-N.
| Molecular formula | C16H30N2O6 |
|---|---|
| Molecular weight | 346.42 g/mol |
| IUPAC name | (2R)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | FBVSXKMMQOZUNU-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)