Products 1314753-85-9
CAS 1314753-85-9 appears in our catalog under these names: L-Lysine-4,4,5,5-d4-bis-N-t-BOC, 98 atom % D, min 98% Chemical Purity, L-Lysine-bis-N-t-BOC-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 5mg, 1mg.
(2S)-4,4,5,5-tetradeuterio-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 1314753-85-9) is a chemical compound with the molecular formula C16H30N2O6 and a molecular weight of 350.44 g/mol. IUPAC name: (2S)-4,4,5,5-tetradeuterio-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: FBVSXKMMQOZUNU-QCSVEXGJSA-N.
| Molecular formula | C16H30N2O6 |
|---|---|
| Molecular weight | 350.44 g/mol |
| IUPAC name | (2S)-4,4,5,5-tetradeuterio-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | FBVSXKMMQOZUNU-QCSVEXGJSA-N |
| SMILES | [2H]C([2H])(C[C@@H](C(=O)O)NC(=O)OC(C)(C)C)C([2H])([2H])CNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)