Boc-D-Ser(tBu)-OH, 95%
cas: 248921-66-6 — see every product listed under this CAS number, including other names
Boc-D-Ser(tBu)-OH, 95% (CAS 248921-66-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 15g, 50g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A500593-1g |
| cas | 248921-66-6 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 298.06 Pln | |
| Ambeed | 10g | 448.25 Pln | |
| Ambeed | 25g | 826.50 Pln | |
| Ambeed | 100g | 2484.12 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 184.40 Pln | |
| Chemat | 15g | 242.00 Pln | |
| Chemat | 25g | 275.60 Pln | |
| Chemat | 50g | 477.20 Pln | |
| Chemat | 100g | 870.80 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 314.36 Pln | |
| BLDpharm | 10g | 480.97 Pln | |
| BLDpharm | 25g | 886.38 Pln | |
| BLDpharm | 100g | 2669.08 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 248921-66-6) is a chemical compound with the molecular formula C12H23NO5 and a molecular weight of 261.31 g/mol. IUPAC name: (2R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: BPYLRGKEIUPMRJ-MRVPVSSYSA-N.
| Molecular formula | C12H23NO5 |
|---|---|
| Molecular weight | 261.31 g/mol |
| IUPAC name | (2R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | BPYLRGKEIUPMRJ-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
boc-d-ser(tbu)-oh, (R)-3-(tert-Butoxy)-2-((tert-butoxycarbonyl)amino)propanoic acid, O-tert-butyl-N-BOC-D-serine, D-Serine, N-[(1,1-dimethylethoxy)carbonyl]-O-(1,1-dimethylethyl)-, Boc-D-serine O-tert-Butyl Ether, (2R)-3-(tert-butoxy)-2-{[(tert-butoxy)carbonyl]amino}propanoic acid, BOC-D-serine t-butyl ether, BPYLRGKEIUPMRJ-MRVPVSSYSA-N, N-(tert-Butoxycarbonyl)-O-tert-butyl-D-serine, N-(tert-Butoxycarbonyl)-O-(tert-butyl)-D-serine
