CAS 248921-66-6 appears in our catalog under these names: Boc–D–Ser(tBu)–OH, Boc-D-Ser(tBu)-OH, 95%, 95%, Boc-D-Ser(tBu)-OH, 97.0%, (R)-3-(tert-Butoxy)-2-((tert-butoxycarbonyl)amino)propanoic acid, 95%, Boc-D-Ser(tBu)-OH, 95%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 25g, 50g, 1g, 5g, 10g, 15g, 100g, 50 g.
(2R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 248921-66-6) is a chemical compound with the molecular formula C12H23NO5 and a molecular weight of 261.31 g/mol. IUPAC name: (2R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: BPYLRGKEIUPMRJ-MRVPVSSYSA-N.
| Molecular formula | C12H23NO5 |
|---|---|
| Molecular weight | 261.31 g/mol |
| IUPAC name | (2R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | BPYLRGKEIUPMRJ-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)