cas: 55674-67-4 — see every product listed under this CAS number, including other names
Boc-D-Thr-OH, 98%, 98% (CAS 55674-67-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0XI-250mg |
| cas | 55674-67-4 |
| size | 250mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 10g | 203.60 Pln | |
| Chemat | 25g | 357.20 Pln | |
| Chemat | 100g | 1096.40 Pln | |
| Chemat | 50g | 650.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 55674-67-4) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: (2R,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LLHOYOCAAURYRL-NTSWFWBYSA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | (2R,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | LLHOYOCAAURYRL-NTSWFWBYSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)NC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)