CAS 23082-30-6 appears in our catalog under these names: (2S,3S)–2–((tert–Butoxycarbonyl)amino)–3–hydroxybutanoic acid, Boc-Allo-Thr-OH 95%, L-Allothreonine, N-[(1,1-dimethylethoxy)carbonyl]-, 95%, 95%, N-Boc-L-Allothreonine, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 100mg, 250mg, 100g, 500g.
(2S,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 23082-30-6) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: (2S,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LLHOYOCAAURYRL-WDSKDSINSA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | (2S,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | LLHOYOCAAURYRL-WDSKDSINSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)O)NC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)