cas: 200937-21-9 — see every product listed under this CAS number, including other names
Boc-DL-Leu-OH.H2O, 98%, 98% (CAS 200937-21-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C286-1g |
| cas | 200937-21-9 |
| size | 1g |
| availability | 700g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 25g | 573.20 Pln | |
| Chemat | 100g | 2008.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate (CAS 200937-21-9) is a chemical compound with the molecular formula C11H23NO5 and a molecular weight of 249.30 g/mol. IUPAC name: 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate. InChIKey: URQQEIOTRWJXBA-UHFFFAOYSA-N.
| Molecular formula | C11H23NO5 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate |
| InChIKey | URQQEIOTRWJXBA-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)NC(=O)OC(C)(C)C.O |
Computed by PubChem (NCBI)