CAS 2756104-04-6 is the registry number for (2S,3S)-3-Methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid hydrate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
(2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate (CAS 2756104-04-6) is a chemical compound with the molecular formula C11H23NO5 and a molecular weight of 249.30 g/mol. IUPAC name: (2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate. InChIKey: YLYHCKPXZULAEG-WSZWBAFRSA-N.
| Molecular formula | C11H23NO5 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | (2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate |
| InChIKey | YLYHCKPXZULAEG-WSZWBAFRSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)NC(=O)OC(C)(C)C.O |
Computed by PubChem (NCBI)