CAS 369403-30-5 appears in our catalog under these names: 2–((tert–Butoxycarbonyl)amino)–2–(3,5–dichlorophenyl)acetic acid, 2-((tert-Butoxycarbonyl)amino)-2-(3,5-dichlorophenyl)acetic acid, 95%, 95%, 2-((tert-Butoxycarbonyl)amino)-2-(3,5-dichlorophenyl)acetic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
2-(3,5-dichlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 369403-30-5) is a chemical compound with the molecular formula C13H15Cl2NO4 and a molecular weight of 320.16 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: KJSGAMITXFBSOT-UHFFFAOYSA-N.
| Molecular formula | C13H15Cl2NO4 |
|---|---|
| Molecular weight | 320.16 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | KJSGAMITXFBSOT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC(=CC(=C1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)