CAS 409127-35-1 is the registry number for methyl4–((tert–butoxycarbonyl)amino)–2,6–dichlorobenzoate. Offered by: GLPBio. Available pack sizes: 100mg.
Methyl 2,6-dichloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate (CAS 409127-35-1) is a chemical compound with the molecular formula C13H15Cl2NO4 and a molecular weight of 320.16 g/mol. IUPAC name: methyl 2,6-dichloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate. InChIKey: KXNKMOCFPSSXHX-UHFFFAOYSA-N.
| Molecular formula | C13H15Cl2NO4 |
|---|---|
| Molecular weight | 320.16 g/mol |
| IUPAC name | methyl 2,6-dichloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate |
| InChIKey | KXNKMOCFPSSXHX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C(=C1)Cl)C(=O)OC)Cl |
Computed by PubChem (NCBI)