cas: 362492-00-0 — see every product listed under this CAS number, including other names
Boc-DL-Tiq(6-OH)-OH 98% (CAS 362492-00-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A456378-100mg |
| cas | 362492-00-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 576.19 Pln | |
| Ambeed | 1g | 998.94 Pln | |
| Ambeed | 5g | 3090.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A456378 |
6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinoline-1-carboxylic acid (CAS 362492-00-0) is a chemical compound with the molecular formula C15H19NO5 and a molecular weight of 293.31 g/mol. IUPAC name: 6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinoline-1-carboxylic acid. InChIKey: KCDBTPOYUDNXBR-UHFFFAOYSA-N.
| Molecular formula | C15H19NO5 |
|---|---|
| Molecular weight | 293.31 g/mol |
| IUPAC name | 6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| InChIKey | KCDBTPOYUDNXBR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1C(=O)O)C=CC(=C2)O |
Computed by PubChem (NCBI)