Products 85263-80-5

CAS 85263-80-5 is the registry number for 1-[2-(3,4-Dimethoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 25g, 5g, 250mg.

Structural formula: {0} (CAS {1})

1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid (CAS 85263-80-5) is a chemical compound with the molecular formula C15H19NO5 and a molecular weight of 293.31 g/mol. IUPAC name: 1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid. InChIKey: LENAMXSEAKOBKB-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19NO5
Molecular weight293.31 g/mol
IUPAC name1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid
InChIKeyLENAMXSEAKOBKB-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)CCN2CC(CC2=O)C(=O)O)OC

Computed by PubChem (NCBI)