cas: 944283-09-4 — see every product listed under this CAS number, including other names
Boc-L-Ser(Fmoc-S-Leu)-OH 98% (CAS 944283-09-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1157388-250mg |
| cas | 944283-09-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1405.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1157388 |
(2S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 944283-09-4) is a chemical compound with the molecular formula C29H36N2O8 and a molecular weight of 540.6 g/mol. IUPAC name: (2S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: ZBFDFHFWCCHHIV-ZEQRLZLVSA-N.
| Molecular formula | C29H36N2O8 |
|---|---|
| Molecular weight | 540.6 g/mol |
| IUPAC name | (2S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | ZBFDFHFWCCHHIV-ZEQRLZLVSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC[C@@H](C(=O)O)NC(=O)OC(C)(C)C)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)