cas: 6404-26-8 — see every product listed under this CAS number, including other names
Boc-Lys(Ac)-OH 97% (CAS 6404-26-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A132987-250mg |
| cas | 6404-26-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 275.81 Pln | |
| Ambeed | 10g | 437.12 Pln | |
| Ambeed | 25g | 854.31 Pln | |
| Ambeed | 100g | 2584.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A132987 |
(2S)-6-acetamido-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 6404-26-8) is a chemical compound with the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. IUPAC name: (2S)-6-acetamido-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: IOKOUUAPSRCSNT-JTQLQIEISA-N.
| Molecular formula | C13H24N2O5 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | (2S)-6-acetamido-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | IOKOUUAPSRCSNT-JTQLQIEISA-N |
| SMILES | CC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)