cas: 950683-55-3 — see every product listed under this CAS number, including other names
Boc-NH-PEG(2)-N3 (CAS 950683-55-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 500mg. Offered by: Iris Biotech.
| brand | Iris Biotech |
|---|---|
| catalog number | PEG4960.0001 |
| cas | 950683-55-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Iris Biotech | 1g | 787.16 Pln | |
| Iris Biotech | 5g | 2367.20 Pln | |
| Iris Biotech | 25g | 9138.80 Pln | |
| Iris Biotech | 500mg | 561.44 Pln |
| purity | No data |
|---|---|
| delivery time | 2 weeks |
Tert-butyl N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]carbamate (CAS 950683-55-3) is a chemical compound with the molecular formula C11H22N4O4 and a molecular weight of 274.32 g/mol. IUPAC name: tert-butyl N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]carbamate. InChIKey: MEZSEFQCLYODJG-UHFFFAOYSA-N.
| Molecular formula | C11H22N4O4 |
|---|---|
| Molecular weight | 274.32 g/mol |
| IUPAC name | tert-butyl N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]carbamate |
| InChIKey | MEZSEFQCLYODJG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCN=[N+]=[N-] |
Computed by PubChem (NCBI)