cas: 950683-55-3 — see every product listed under this CAS number, including other names
1-(Boc-amino)-3,6-dioxa-8-octaneazide, 98% (CAS 950683-55-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F494418-1G |
| cas | 950683-55-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 903.87 Pln | |
| Fluorochem | 5g | 3064.56 Pln | |
| Fluorochem | 10g | 5516.83 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]carbamate (CAS 950683-55-3) is a chemical compound with the molecular formula C11H22N4O4 and a molecular weight of 274.32 g/mol. IUPAC name: tert-butyl N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]carbamate. InChIKey: MEZSEFQCLYODJG-UHFFFAOYSA-N.
| Molecular formula | C11H22N4O4 |
|---|---|
| Molecular weight | 274.32 g/mol |
| IUPAC name | tert-butyl N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]carbamate |
| InChIKey | MEZSEFQCLYODJG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCN=[N+]=[N-] |
Computed by PubChem (NCBI)