cas: 206265-98-7 — see every product listed under this CAS number, including other names
Boc-NH-PEG7-NH2 98% (CAS 206265-98-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A556004-100mg |
| cas | 206265-98-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 604.00 Pln | |
| Ambeed | 5g | 2734.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A556004 |
Tert-butyl N-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (CAS 206265-98-7) is a chemical compound with the molecular formula C21H44N2O9 and a molecular weight of 468.6 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate. InChIKey: HTIMIYPOESODPC-UHFFFAOYSA-N.
| Molecular formula | C21H44N2O9 |
|---|---|
| Molecular weight | 468.6 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | HTIMIYPOESODPC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)