cas: 206265-98-7 — see every product listed under this CAS number, including other names
tert-Butyl (23-amino-3,6,9,12,15,18,21-heptaoxatricosyl)carbamate, 95% (CAS 206265-98-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546480-100MG |
| cas | 206265-98-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 1g | 565.44 Pln | |
| Fluorochem | 5g | 2601.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (CAS 206265-98-7) is a chemical compound with the molecular formula C21H44N2O9 and a molecular weight of 468.6 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate. InChIKey: HTIMIYPOESODPC-UHFFFAOYSA-N.
| Molecular formula | C21H44N2O9 |
|---|---|
| Molecular weight | 468.6 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | HTIMIYPOESODPC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)