CAS 57133-29-6 appears in our catalog under these names: Boc–Orn(Boc)–OH, Boc-L-Orn(Boc)-OH, (S)-2,5-Bis-tert-butoxycarbonylamino-pentanoic acid, 97%, 97%, (S)-2,5-Bis((tert-butoxycarbonyl)amino)pentanoic acid, 95%. Offered by: GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 500g.
(2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 57133-29-6) is a chemical compound with the molecular formula C15H28N2O6 and a molecular weight of 332.39 g/mol. IUPAC name: (2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: RJOJSMIZZYHNQG-JTQLQIEISA-N.
| Molecular formula | C15H28N2O6 |
|---|---|
| Molecular weight | 332.39 g/mol |
| IUPAC name | (2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | RJOJSMIZZYHNQG-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)NCCC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)