CAS 2253619-68-8 is the registry number for (3S)-3,5-Bis({((tert-butoxy)carbonyl)amino})pentanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3S)-3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 2253619-68-8) is a chemical compound with the molecular formula C15H28N2O6 and a molecular weight of 332.39 g/mol. IUPAC name: (3S)-3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: CESMRPBQOJNEKK-JTQLQIEISA-N.
| Molecular formula | C15H28N2O6 |
|---|---|
| Molecular weight | 332.39 g/mol |
| IUPAC name | (3S)-3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | CESMRPBQOJNEKK-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)NCC[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)