Boc-Orn(Boc)-OH, 97%
cas: 57133-29-6 — see every product listed under this CAS number, including other names
Boc-Orn(Boc)-OH, 97% (CAS 57133-29-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A148414-1g |
| cas | 57133-29-6 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 175.69 Pln | |
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 492.75 Pln | |
| Ambeed | 500g | 1861.13 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 10g | 186.63 Pln | |
| BLDpharm | 25g | 214.39 Pln | |
| BLDpharm | 100g | 525.40 Pln | |
| BLDpharm | 500g | 1669.44 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 57133-29-6) is a chemical compound with the molecular formula C15H28N2O6 and a molecular weight of 332.39 g/mol. IUPAC name: (2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: RJOJSMIZZYHNQG-JTQLQIEISA-N.
| Molecular formula | C15H28N2O6 |
|---|---|
| Molecular weight | 332.39 g/mol |
| IUPAC name | (2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | RJOJSMIZZYHNQG-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)NCCC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
BOC-ORN(BOC)-OH, (S)-2,5-Bis((tert-butoxycarbonyl)amino)pentanoic acid, N2,N5-Di-Boc-L-ornithine, Boc-Orn(Boc), N,N'-bis-BOC-ornithine, N,N'-Di(Boc)-L-ornithine, Boc-L-Orn(Boc)-OH, N2,N5-bis(tert-butoxycarbonyl)-L-ornithine, Nalpha,Ndelta-bis-Boc-ornithine, (2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid
