CAS 252897-67-9 appears in our catalog under these names: Boc-Ser(trt)-OH, 95+%, Boc-Ser(Trt)-OH, 98%, 98%, Boc-Ser(trt)-OH, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-trityloxypropanoic acid (CAS 252897-67-9) is a chemical compound with the molecular formula C27H29NO5 and a molecular weight of 447.5 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-trityloxypropanoic acid. InChIKey: PYLMUAAMLWWXJX-QHCPKHFHSA-N.
| Molecular formula | C27H29NO5 |
|---|---|
| Molecular weight | 447.5 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-trityloxypropanoic acid |
| InChIKey | PYLMUAAMLWWXJX-QHCPKHFHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)