Products 2217671-64-0

CAS 2217671-64-0 is the registry number for MIR002, 99.0%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 50 mg, 100 mg, 25 mg, 10 mg.

Structural formula: {0} (CAS {1})

(E)-3-[4-[3-(1-adamantyl)-4-[2-(hydroxyamino)-2-oxoethoxy]phenyl]phenyl]prop-2-enoic acid (CAS 2217671-64-0) is a chemical compound with the molecular formula C27H29NO5 and a molecular weight of 447.5 g/mol. IUPAC name: (E)-3-[4-[3-(1-adamantyl)-4-[2-(hydroxyamino)-2-oxoethoxy]phenyl]phenyl]prop-2-enoic acid. InChIKey: YJMADWAPLKRSFA-FPYGCLRLSA-N.

Identity
Molecular formulaC27H29NO5
Molecular weight447.5 g/mol
IUPAC name(E)-3-[4-[3-(1-adamantyl)-4-[2-(hydroxyamino)-2-oxoethoxy]phenyl]phenyl]prop-2-enoic acid
InChIKeyYJMADWAPLKRSFA-FPYGCLRLSA-N
SMILESC1C2CC3CC1CC(C2)(C3)C4=C(C=CC(=C4)C5=CC=C(C=C5)/C=C/C(=O)O)OCC(=O)NO

Computed by PubChem (NCBI)

Synonyms: orb1687125