Boc-Ser-Otbu, 95%
cas: 7738-22-9 — see every product listed under this CAS number, including other names
Boc-Ser-Otbu, 95% (CAS 7738-22-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg, 100mg, 50g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F212320-1G |
| cas | 7738-22-9 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 544.62 Pln | |
| Fluorochem | 10g | 919.49 Pln | |
| Fluorochem | 25g | 2122.19 Pln | |
| Fluorochem | 100g | 6573.74 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 559.50 Pln | |
| Ambeed | 25g | 2066.94 Pln | |
| Ambeed | 100g | 6544.75 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 10g | 683.60 Pln | |
| Chemat | 25g | 1302.80 Pln | |
| Chemat | 50g | 2128.40 Pln | |
| Chemat | 100g | 3506.00 Pln | |
| Chemat | 250g | 4115.60 Pln | |
| Chemat | 500g | 7435.20 Pln | |
| BLDpharm | 250mg | 203.29 Pln | |
| BLDpharm | 1g | 292.14 Pln | |
| BLDpharm | 5g | 603.15 Pln | |
| BLDpharm | 25g | 2219.24 Pln | |
| BLDpharm | 100g | 7056.43 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Tert-butyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 7738-22-9) is a chemical compound with the molecular formula C12H23NO5 and a molecular weight of 261.31 g/mol. IUPAC name: tert-butyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: NSNZHQVMWJPBPI-QMMMGPOBSA-N.
| Molecular formula | C12H23NO5 |
|---|---|
| Molecular weight | 261.31 g/mol |
| IUPAC name | tert-butyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | NSNZHQVMWJPBPI-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CO)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Boc-Ser-Otbu, Boc-L-Serine tert-butyl ester, N-Boc-L-serine tert-butyl ester, (S)-tert-Butyl 2-((tert-butoxycarbonyl)amino)-3-hydroxypropanoate, L-Serine, N-[(1,1-dimethylethoxy)carbonyl]-, 1,1-dimethylethyl ester, tert-butyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate, tert-butyl (2S)-2-(tert-butoxycarbonylamino)-3-hydroxy-propanoate, tert-Butyl (tert-butoxycarbonyl)-L-serinate, L-Serine, N-[(1,1-dimethyl, NSNZHQVMWJPBPI-QMMMGPOBSA-N