cas: 909115-21-5 — see every product listed under this CAS number, including other names
Boc-Thr(Fmoc-Ala)-OH 98% (CAS 909115-21-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1157299-100mg |
| cas | 909115-21-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 909.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1157299 |
(2S,3R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 909115-21-5) is a chemical compound with the molecular formula C27H32N2O8 and a molecular weight of 512.6 g/mol. IUPAC name: (2S,3R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: QBYYWPMYAPYVGF-DMPWYTOCSA-N.
| Molecular formula | C27H32N2O8 |
|---|---|
| Molecular weight | 512.6 g/mol |
| IUPAC name | (2S,3R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | QBYYWPMYAPYVGF-DMPWYTOCSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OC(C)(C)C)OC(=O)[C@H](C)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)