cas: 3392-12-9 — see every product listed under this CAS number, including other names
Boc-Val-OSu, 97% (CAS 3392-12-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A340967-5g |
| cas | 3392-12-9 |
| size | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 10g | 159.00 Pln | |
| Ambeed | 25g | 209.06 Pln | |
| Ambeed | 100g | 587.31 Pln | |
| Ambeed | 500g | 2600.94 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 10g | 164.41 Pln | |
| BLDpharm | 25g | 219.95 Pln | |
| BLDpharm | 100g | 630.91 Pln | |
| BLDpharm | 500g | 2796.82 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2,5-dioxopyrrolidin-1-yl) (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 3392-12-9) is a chemical compound with the molecular formula C14H22N2O6 and a molecular weight of 314.33 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: POBDBYGSGKMZPH-NSHDSACASA-N.
| Molecular formula | C14H22N2O6 |
|---|---|
| Molecular weight | 314.33 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | POBDBYGSGKMZPH-NSHDSACASA-N |
| SMILES | CC(C)[C@@H](C(=O)ON1C(=O)CCC1=O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)