CAS 1417526-05-6 appears in our catalog under these names: Glutamic Acid Impurity 4, N-Boc-4-(cyanomethyl)-L-glutamic Acid 1,5-Dimethyl Ester, Dimethyl (2S)–2–((tert–butoxycarbonyl)amino)–4–(cyanomethyl)pentanedioate. Offered by: Chemat Brand, TRC, GLPBio. Available pack sizes: on request, 2,5g, 1g.
Dimethyl (4S)-2-(cyanomethyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (CAS 1417526-05-6) is a chemical compound with the molecular formula C14H22N2O6 and a molecular weight of 314.33 g/mol. IUPAC name: dimethyl (4S)-2-(cyanomethyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate. InChIKey: QVTOOWHELURIDU-AXDSSHIGSA-N.
| Molecular formula | C14H22N2O6 |
|---|---|
| Molecular weight | 314.33 g/mol |
| IUPAC name | dimethyl (4S)-2-(cyanomethyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| InChIKey | QVTOOWHELURIDU-AXDSSHIGSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(CC#N)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)