cas: 153074-95-4 — see every product listed under this CAS number, including other names
Boc-trans-4-benzyl-L-proline, 97% (CAS 153074-95-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F300041-100MG |
| cas | 153074-95-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 690.40 Pln | |
| Fluorochem | 250mg | 1216.26 Pln | |
| Fluorochem | 1g | 3189.52 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2S,4R)-4-benzyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 153074-95-4) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: (2S,4R)-4-benzyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: JPNHKKRLLDYCIZ-KGLIPLIRSA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | (2S,4R)-4-benzyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | JPNHKKRLLDYCIZ-KGLIPLIRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)