CAS 83623-78-3 appears in our catalog under these names: Boc-cis-4-Bzl-Pro-OH, 97%, Boc-cis-4-Bzl-Pro-OH 95%, (2S,4S)-4-Benzyl-1-(tert-butoxycarbonyl)pyrrolidine-2-carboxylic acid, 95%, 95%, (4S)-1-Boc-4-benzyl-L-proline, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(2S,4S)-4-benzyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 83623-78-3) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: (2S,4S)-4-benzyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: JPNHKKRLLDYCIZ-KBPBESRZSA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | (2S,4S)-4-benzyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | JPNHKKRLLDYCIZ-KBPBESRZSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)