Br-PEG4-CH2-Boc, 97.46%
cas: 1807505-29-8 — see every product listed under this CAS number, including other names
Br-PEG4-CH2-Boc, 97.46% (CAS 1807505-29-8) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 5 g, 100 mg, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-130536-1 g |
| cas | 1807505-29-8 |
| size | 1 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 937.34 Pln | |
| MedChemExpress | 5 g | 4076.69 Pln | |
| MedChemExpress | 100 mg | 263.96 Pln | |
| MedChemExpress | 250 mg | 361.49 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.46% |
Tert-butyl 2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]acetate (CAS 1807505-29-8) is a chemical compound with the molecular formula C14H27BrO6 and a molecular weight of 371.26 g/mol. IUPAC name: tert-butyl 2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]acetate. InChIKey: PELYBQFWTCXTNW-UHFFFAOYSA-N.
| Molecular formula | C14H27BrO6 |
|---|---|
| Molecular weight | 371.26 g/mol |
| IUPAC name | tert-butyl 2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]acetate |
| InChIKey | PELYBQFWTCXTNW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCBr |
Computed by PubChem (NCBI)