cas: 1807505-29-8 — see every product listed under this CAS number, including other names
tert-Butyl 14-bromo-3,6,9,12-tetraoxatetradecanoate, 95% (CAS 1807505-29-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F867237-100MG |
| cas | 1807505-29-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 778.91 Pln | |
| Fluorochem | 5g | 2825.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]acetate (CAS 1807505-29-8) is a chemical compound with the molecular formula C14H27BrO6 and a molecular weight of 371.26 g/mol. IUPAC name: tert-butyl 2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]acetate. InChIKey: PELYBQFWTCXTNW-UHFFFAOYSA-N.
| Molecular formula | C14H27BrO6 |
|---|---|
| Molecular weight | 371.26 g/mol |
| IUPAC name | tert-butyl 2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]acetate |
| InChIKey | PELYBQFWTCXTNW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCBr |
Computed by PubChem (NCBI)