cas: 342795-08-8 — see every product listed under this CAS number, including other names
Bragsin2 (CAS 342795-08-8) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC64939-10 |
| cas | 342795-08-8 |
| size | 10mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 966.80 Pln | |
| GLPBio | 100mg | 3236.84 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 793.62 Pln | |
| GLPBio | 25mg | 1519.10 Pln | |
| GLPBio | 5mg | 760.86 Pln | |
| GLPBio | 50mg | 2179.05 Pln | |
| Chemat | 1mg | 170.00 Pln | |
| Chemat | 5mg | 333.20 Pln | |
| Chemat | 10mg | 501.20 Pln | |
| Chemat | 25mg | 947.60 Pln | |
| Chemat | 50mg | 1485.20 Pln | |
| Chemat | 100mg | 2104.40 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
6-methoxy-5-nitro-2-(trifluoromethyl)chromen-4-one (CAS 342795-08-8) is a chemical compound with the molecular formula C11H6F3NO5 and a molecular weight of 289.16 g/mol. IUPAC name: 6-methoxy-5-nitro-2-(trifluoromethyl)chromen-4-one. InChIKey: WJUILHMXVGFAIS-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO5 |
|---|---|
| Molecular weight | 289.16 g/mol |
| IUPAC name | 6-methoxy-5-nitro-2-(trifluoromethyl)chromen-4-one |
| InChIKey | WJUILHMXVGFAIS-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)OC(=CC2=O)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)