CAS 342795-08-8 appears in our catalog under these names: Bragsin2, 99+%, Bragsin2/ 98.47% (existing batch purity), Bragsin2, Bragsin 2, Bragsin2, 99.85%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 1mg, 100 mg.
6-methoxy-5-nitro-2-(trifluoromethyl)chromen-4-one (CAS 342795-08-8) is a chemical compound with the molecular formula C11H6F3NO5 and a molecular weight of 289.16 g/mol. IUPAC name: 6-methoxy-5-nitro-2-(trifluoromethyl)chromen-4-one. InChIKey: WJUILHMXVGFAIS-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO5 |
|---|---|
| Molecular weight | 289.16 g/mol |
| IUPAC name | 6-methoxy-5-nitro-2-(trifluoromethyl)chromen-4-one |
| InChIKey | WJUILHMXVGFAIS-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)OC(=CC2=O)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)