cas: 1415800-44-0 — see every product listed under this CAS number, including other names
Bromoacetamido-PEG2-C2-acid, 95% (CAS 1415800-44-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F987019-100MG |
| cas | 1415800-44-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 747.67 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]propanoic acid (CAS 1415800-44-0) is a chemical compound with the molecular formula C9H16BrNO5 and a molecular weight of 298.13 g/mol. IUPAC name: 3-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]propanoic acid. InChIKey: PIANHFIJCGRNCU-UHFFFAOYSA-N.
| Molecular formula | C9H16BrNO5 |
|---|---|
| Molecular weight | 298.13 g/mol |
| IUPAC name | 3-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]propanoic acid |
| InChIKey | PIANHFIJCGRNCU-UHFFFAOYSA-N |
| SMILES | C(COCCOCCNC(=O)CBr)C(=O)O |
Computed by PubChem (NCBI)