cas: 1415800-44-0 — see every product listed under this CAS number, including other names
Bromoacetamido-PEG2-C2-acid (CAS 1415800-44-0) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | T14817-5mg |
| cas | 1415800-44-0 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 5mg | 412.42 Pln | |
| TargetMol | 10mg | 492.36 Pln | |
| TargetMol | 25mg | 677.95 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 26 days |
3-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]propanoic acid (CAS 1415800-44-0) is a chemical compound with the molecular formula C9H16BrNO5 and a molecular weight of 298.13 g/mol. IUPAC name: 3-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]propanoic acid. InChIKey: PIANHFIJCGRNCU-UHFFFAOYSA-N.
| Molecular formula | C9H16BrNO5 |
|---|---|
| Molecular weight | 298.13 g/mol |
| IUPAC name | 3-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]propanoic acid |
| InChIKey | PIANHFIJCGRNCU-UHFFFAOYSA-N |
| SMILES | C(COCCOCCNC(=O)CBr)C(=O)O |
Computed by PubChem (NCBI)