cas: 1421933-39-2 — see every product listed under this CAS number, including other names
Bromoacetamido-PEG3-NH-Boc 95% (CAS 1421933-39-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A756030-100mg |
| cas | 1421933-39-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 342.56 Pln | |
| Ambeed | 5g | 1377.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A756030 |
Tert-butyl N-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate (CAS 1421933-39-2) is a chemical compound with the molecular formula C15H29BrN2O6 and a molecular weight of 413.30 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate. InChIKey: LJDJJTQGFJMIKR-UHFFFAOYSA-N.
| Molecular formula | C15H29BrN2O6 |
|---|---|
| Molecular weight | 413.30 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | LJDJJTQGFJMIKR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCNC(=O)CBr |
Computed by PubChem (NCBI)