cas: 1421933-39-2 — see every product listed under this CAS number, including other names
tert-Butyl (1-bromo-2-oxo-6,9,12-trioxa-3-azatetradecan-14-yl)carbamate, 98% (CAS 1421933-39-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F867248-1G |
| cas | 1421933-39-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 351.98 Pln | |
| Fluorochem | 5g | 1507.82 Pln | |
| Fluorochem | 10g | 2965.64 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate (CAS 1421933-39-2) is a chemical compound with the molecular formula C15H29BrN2O6 and a molecular weight of 413.30 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate. InChIKey: LJDJJTQGFJMIKR-UHFFFAOYSA-N.
| Molecular formula | C15H29BrN2O6 |
|---|---|
| Molecular weight | 413.30 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | LJDJJTQGFJMIKR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCNC(=O)CBr |
Computed by PubChem (NCBI)