Products 2104030-82-0
CAS 2104030-82-0 appears in our catalog under these names: Brr2–IN–3, Brr2-IN-3/ 99.12% (existing batch purity), Brr2 inhibitor C9, Brr2-IN-3 99%, 6-Benzyl-3-(3-(thiazol-5-ylmethoxy)phenyl)-3,4-dihydropyrido[4,3-d]pyrimidine-2,7(1H,6H)-dione, 99%, 99%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 1mg, 2mg, 200mg.
6-benzyl-3-[3-(1,3-thiazol-5-ylmethoxy)phenyl]-1,4-dihydropyrido[4,3-d]pyrimidine-2,7-dione (CAS 2104030-82-0) is a chemical compound with the molecular formula C24H20N4O3S and a molecular weight of 444.5 g/mol. IUPAC name: 6-benzyl-3-[3-(1,3-thiazol-5-ylmethoxy)phenyl]-1,4-dihydropyrido[4,3-d]pyrimidine-2,7-dione. InChIKey: GAWVULNDIBAUHU-UHFFFAOYSA-N.
| Molecular formula | C24H20N4O3S |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | 6-benzyl-3-[3-(1,3-thiazol-5-ylmethoxy)phenyl]-1,4-dihydropyrido[4,3-d]pyrimidine-2,7-dione |
| InChIKey | GAWVULNDIBAUHU-UHFFFAOYSA-N |
| SMILES | C1C2=CN(C(=O)C=C2NC(=O)N1C3=CC(=CC=C3)OCC4=CN=CS4)CC5=CC=CC=C5 |
Computed by PubChem (NCBI)