Products 1558036-85-3
CAS 1558036-85-3 appears in our catalog under these names: Btk inhibitor 2/ 99.49% (existing batch purity), Btk inhibitor 2, Btk inhibitor 2, Btk inhibitor 2, 99.57%, Btk inhibitor 2 (Standard). Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
5-amino-3-(4-phenoxyphenyl)-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazole-4-carboxamide (CAS 1558036-85-3) is a chemical compound with the molecular formula C24H25N5O3 and a molecular weight of 431.5 g/mol. IUPAC name: 5-amino-3-(4-phenoxyphenyl)-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazole-4-carboxamide. InChIKey: WTLRSSATGYETCG-QGZVFWFLSA-N.
| Molecular formula | C24H25N5O3 |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | 5-amino-3-(4-phenoxyphenyl)-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazole-4-carboxamide |
| InChIKey | WTLRSSATGYETCG-QGZVFWFLSA-N |
| SMILES | C=CC(=O)N1CCC[C@H](C1)N2C(=C(C(=N2)C3=CC=C(C=C3)OC4=CC=CC=C4)C(=O)N)N |
Computed by PubChem (NCBI)