cas: 29684-56-8 — see every product listed under this CAS number, including other names
Burgess reagent 95% (CAS 29684-56-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A699984-1g |
| cas | 29684-56-8 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 670.75 Pln | |
| Ambeed | 500g | 1900.06 Pln | |
| Ambeed | 1000g | 2728.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A699984 |
(1E)-1-methoxy-N-(triethylazaniumyl)sulfonylmethanimidate (CAS 29684-56-8) is a chemical compound with the molecular formula C8H18N2O4S and a molecular weight of 238.31 g/mol. IUPAC name: (1E)-1-methoxy-N-(triethylazaniumyl)sulfonylmethanimidate. InChIKey: YSHOWEKUVWPFNR-UHFFFAOYSA-N.
| Molecular formula | C8H18N2O4S |
|---|---|
| Molecular weight | 238.31 g/mol |
| IUPAC name | (1E)-1-methoxy-N-(triethylazaniumyl)sulfonylmethanimidate |
| InChIKey | YSHOWEKUVWPFNR-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CC)S(=O)(=O)/N=C(\[O-])/OC |
Computed by PubChem (NCBI)